C15H22O6 — CID 10870243
(3aS,7R,7aS)-7-hydroxy-6-(methoxymethoxymethyl)spiro[7,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4-one (PubChem CID 10870243) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is (3aS,7R,7aS)-7-hydroxy-6-(methoxymethoxymethyl)spiro[7,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4-one.
| Compound Name | (3aS,7R,7aS)-7-hydroxy-6-(methoxymethoxymethyl)spiro[7,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 10870243 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (3aS,7R,7aS)-7-hydroxy-6-(methoxymethoxymethyl)spiro[7,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4-one |
| SMILES | COCOCC1=CC(=O)[C@H]2OC3(CCCCC3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C15H22O6/c1-18-9-19-8-10-7-11(16)13-14(12(10)17)21-15(20-13)5-3-2-4-6-15/h7,12-14,17H,2-6,8-9H2,1H3/t12-,13-,14+/m1/s1 |
| InChIKey | QWHNHERHNHKCQQ-MCIONIFRSA-N |
| XLogP | 0.92 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|