C27H22FNO6 — CID 108708383
ethyl 2-[4-[(3E)-3-[(4-fluorophenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate (PubChem CID 108708383) has the molecular formula C27H22FNO6 and a molecular weight of 475.47 g/mol. Its IUPAC name is ethyl 2-[4-[(3E)-3-[(4-fluorophenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[(3E)-3-[(4-fluorophenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 108708383 |
| Molecular Formula | C27H22FNO6 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | ethyl 2-[4-[(3E)-3-[(4-fluorophenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(F)cc3)C2c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H22FNO6/c1-2-35-22(31)15-16-3-11-20(12-4-16)29-24(17-7-13-21(30)14-8-17)23(26(33)27(29)34)25(32)18-5-9-19(28)10-6-18/h3-14,24,30,32H,2,15H2,1H3/b25-23+ |
| InChIKey | XNLVAHRHOZTMNF-WJTDDFOZSA-N |
| XLogP | 4.26 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|