C32H32N2O6 — CID 108713413
propan-2-yl 4-[[(3Z)-3-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate (PubChem CID 108713413) has the molecular formula C32H32N2O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is propan-2-yl 4-[[(3Z)-3-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate.
| Compound Name | propan-2-yl 4-[[(3Z)-3-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 108713413 |
| Molecular Formula | C32H32N2O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | propan-2-yl 4-[[(3Z)-3-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate |
| SMILES | Cc1cccc(C2/C(=C(/O)c3ccc4c(c3)N(C)CCO4)C(=O)C(=O)N2Cc2ccc(C(=O)OC(C)C)cc2)c1 |
| InChI | InChI=1S/C32H32N2O6/c1-19(2)40-32(38)22-10-8-21(9-11-22)18-34-28(23-7-5-6-20(3)16-23)27(30(36)31(34)37)29(35)24-12-13-26-25(17-24)33(4)14-15-39-26/h5-13,16-17,19,28,35H,14-15,18H2,1-4H3/b29-27- |
| InChIKey | LLZKELVRNLZLDL-OHYPFYFLSA-N |
| XLogP | 5.01 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|