C29H26ClNO5 — CID 108713494
propyl 4-[[(3E)-3-[(3-chlorophenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate (PubChem CID 108713494) has the molecular formula C29H26ClNO5 and a molecular weight of 503.98 g/mol. Its IUPAC name is propyl 4-[[(3E)-3-[(3-chlorophenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate.
| Compound Name | propyl 4-[[(3E)-3-[(3-chlorophenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 108713494 |
| Molecular Formula | C29H26ClNO5 |
| Molecular Weight | 503.98 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | propyl 4-[[(3E)-3-[(3-chlorophenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate |
| SMILES | CCCOC(=O)c1ccc(CN2C(=O)C(=O)/C(=C(/O)c3cccc(Cl)c3)C2c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C29H26ClNO5/c1-3-14-36-29(35)20-12-10-19(11-13-20)17-31-25(21-7-4-6-18(2)15-21)24(27(33)28(31)34)26(32)22-8-5-9-23(30)16-22/h4-13,15-16,25,32H,3,14,17H2,1-2H3/b26-24+ |
| InChIKey | MWLQRODZGHSXLR-SHHOIMCASA-N |
| XLogP | 5.84 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.98 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|