C31H29NO7 — CID 108713731
propan-2-yl 2-[4-[(3Z)-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate (PubChem CID 108713731) has the molecular formula C31H29NO7 and a molecular weight of 527.57 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(3Z)-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate.
| Compound Name | propan-2-yl 2-[4-[(3Z)-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 108713731 |
| Molecular Formula | C31H29NO7 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | propan-2-yl 2-[4-[(3Z)-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetate |
| SMILES | Cc1cccc(C2/C(=C(/O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2c2ccc(CC(=O)OC(C)C)cc2)c1 |
| InChI | InChI=1S/C31H29NO7/c1-18(2)39-26(33)16-20-7-10-23(11-8-20)32-28(21-6-4-5-19(3)15-21)27(30(35)31(32)36)29(34)22-9-12-24-25(17-22)38-14-13-37-24/h4-12,15,17-18,28,34H,13-14,16H2,1-3H3/b29-27- |
| InChIKey | LTPLVVMQLZDASO-OHYPFYFLSA-N |
| XLogP | 4.89 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|