C23H28N2O — CID 10871767
(2R,3S)-3-cyclohexyl-2-(dibenzylamino)-3-hydroxypropanenitrile (PubChem CID 10871767) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is (2R,3S)-3-cyclohexyl-2-(dibenzylamino)-3-hydroxypropanenitrile.
| Compound Name | (2R,3S)-3-cyclohexyl-2-(dibenzylamino)-3-hydroxypropanenitrile |
|---|---|
| PubChem CID | 10871767 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (2R,3S)-3-cyclohexyl-2-(dibenzylamino)-3-hydroxypropanenitrile |
| SMILES | N#C[C@H]([C@@H](O)C1CCCCC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H28N2O/c24-16-22(23(26)21-14-8-3-9-15-21)25(17-19-10-4-1-5-11-19)18-20-12-6-2-7-13-20/h1-2,4-7,10-13,21-23,26H,3,8-9,14-15,17-18H2/t22-,23+/m1/s1 |
| InChIKey | UAWOOVMUNHABKC-PKTZIBPZSA-N |
| XLogP | 4.52 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |