C20H22O4S — CID 10872050
(E,2R)-5-(benzenesulfonyl)-3,3-dimethyl-2-phenylmethoxypent-4-enal (PubChem CID 10872050) has the molecular formula C20H22O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is (E,2R)-5-(benzenesulfonyl)-3,3-dimethyl-2-phenylmethoxypent-4-enal.
| Compound Name | (E,2R)-5-(benzenesulfonyl)-3,3-dimethyl-2-phenylmethoxypent-4-enal |
|---|---|
| PubChem CID | 10872050 |
| Molecular Formula | C20H22O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (E,2R)-5-(benzenesulfonyl)-3,3-dimethyl-2-phenylmethoxypent-4-enal |
| SMILES | CC(C)(/C=C/S(=O)(=O)c1ccccc1)[C@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H22O4S/c1-20(2,13-14-25(22,23)18-11-7-4-8-12-18)19(15-21)24-16-17-9-5-3-6-10-17/h3-15,19H,16H2,1-2H3/b14-13+/t19-/m0/s1 |
| InChIKey | ZFSRXFGIJYUENU-KQDNUWKFSA-N |
| XLogP | 3.78 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|