C20H23FO4S — CID 59109009
3-[4-fluoro-2-[[3-(methoxymethyl)phenyl]methyl]phenyl]sulfonyl-2,2-dimethylpropanal (PubChem CID 59109009) has the molecular formula C20H23FO4S and a molecular weight of 378.47 g/mol. Its IUPAC name is 3-[4-fluoro-2-[[3-(methoxymethyl)phenyl]methyl]phenyl]sulfonyl-2,2-dimethylpropanal.
| Compound Name | 3-[4-fluoro-2-[[3-(methoxymethyl)phenyl]methyl]phenyl]sulfonyl-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 59109009 |
| Molecular Formula | C20H23FO4S |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 3-[4-fluoro-2-[[3-(methoxymethyl)phenyl]methyl]phenyl]sulfonyl-2,2-dimethylpropanal |
| SMILES | COCc1cccc(Cc2cc(F)ccc2S(=O)(=O)CC(C)(C)C=O)c1 |
| InChI | InChI=1S/C20H23FO4S/c1-20(2,13-22)14-26(23,24)19-8-7-18(21)11-17(19)10-15-5-4-6-16(9-15)12-25-3/h4-9,11,13H,10,12,14H2,1-3H3 |
| InChIKey | DNJRSDCXPVHDHT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|