C26H35FO2S — CID 20728380
2-butyl-2-[[4-fluoro-2-[[3-(methoxymethyl)phenyl]methyl]phenyl]sulfanylmethyl]hexanal (PubChem CID 20728380) has the molecular formula C26H35FO2S and a molecular weight of 430.63 g/mol. Its IUPAC name is 2-butyl-2-[[4-fluoro-2-[[3-(methoxymethyl)phenyl]methyl]phenyl]sulfanylmethyl]hexanal.
| Compound Name | 2-butyl-2-[[4-fluoro-2-[[3-(methoxymethyl)phenyl]methyl]phenyl]sulfanylmethyl]hexanal |
|---|---|
| PubChem CID | 20728380 |
| Molecular Formula | C26H35FO2S |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 2-butyl-2-[[4-fluoro-2-[[3-(methoxymethyl)phenyl]methyl]phenyl]sulfanylmethyl]hexanal |
| SMILES | CCCCC(C=O)(CCCC)CSc1ccc(F)cc1Cc1cccc(COC)c1 |
| InChI | InChI=1S/C26H35FO2S/c1-4-6-13-26(19-28,14-7-5-2)20-30-25-12-11-24(27)17-23(25)16-21-9-8-10-22(15-21)18-29-3/h8-12,15,17,19H,4-7,13-14,16,18,20H2,1-3H3 |
| InChIKey | HTQYJIJJHFTZLE-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|