C26H37FO2S — CID 20728379
2-butyl-2-[[4-fluoro-2-[[3-(methoxymethyl)phenyl]methyl]phenyl]sulfanylmethyl]hexan-1-ol (PubChem CID 20728379) has the molecular formula C26H37FO2S and a molecular weight of 432.65 g/mol. Its IUPAC name is 2-butyl-2-[[4-fluoro-2-[[3-(methoxymethyl)phenyl]methyl]phenyl]sulfanylmethyl]hexan-1-ol.
| Compound Name | 2-butyl-2-[[4-fluoro-2-[[3-(methoxymethyl)phenyl]methyl]phenyl]sulfanylmethyl]hexan-1-ol |
|---|---|
| PubChem CID | 20728379 |
| Molecular Formula | C26H37FO2S |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 2-butyl-2-[[4-fluoro-2-[[3-(methoxymethyl)phenyl]methyl]phenyl]sulfanylmethyl]hexan-1-ol |
| SMILES | CCCCC(CO)(CCCC)CSc1ccc(F)cc1Cc1cccc(COC)c1 |
| InChI | InChI=1S/C26H37FO2S/c1-4-6-13-26(19-28,14-7-5-2)20-30-25-12-11-24(27)17-23(25)16-21-9-8-10-22(15-21)18-29-3/h8-12,15,17,28H,4-7,13-14,16,18-20H2,1-3H3 |
| InChIKey | FIEOTYZQZUWKPW-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |