C25H35FO2S — CID 21333699
2-butyl-2-[[4-fluoro-2-[(3-methoxyphenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol (PubChem CID 21333699) has the molecular formula C25H35FO2S and a molecular weight of 418.62 g/mol. Its IUPAC name is 2-butyl-2-[[4-fluoro-2-[(3-methoxyphenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol.
| Compound Name | 2-butyl-2-[[4-fluoro-2-[(3-methoxyphenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol |
|---|---|
| PubChem CID | 21333699 |
| Molecular Formula | C25H35FO2S |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2-butyl-2-[[4-fluoro-2-[(3-methoxyphenyl)methyl]phenyl]sulfanylmethyl]hexan-1-ol |
| SMILES | CCCCC(CO)(CCCC)CSc1ccc(F)cc1Cc1cccc(OC)c1 |
| InChI | InChI=1S/C25H35FO2S/c1-4-6-13-25(18-27,14-7-5-2)19-29-24-12-11-22(26)17-21(24)15-20-9-8-10-23(16-20)28-3/h8-12,16-17,27H,4-7,13-15,18-19H2,1-3H3 |
| InChIKey | WIOITODSQUQECZ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |