C26H37FOS — CID 20828972
3-butyl-3-[[2-[(4-fluorophenyl)methyl]-4-methylphenyl]sulfanylmethyl]heptan-2-ol (PubChem CID 20828972) has the molecular formula C26H37FOS and a molecular weight of 416.65 g/mol. Its IUPAC name is 3-butyl-3-[[2-[(4-fluorophenyl)methyl]-4-methylphenyl]sulfanylmethyl]heptan-2-ol.
| Compound Name | 3-butyl-3-[[2-[(4-fluorophenyl)methyl]-4-methylphenyl]sulfanylmethyl]heptan-2-ol |
|---|---|
| PubChem CID | 20828972 |
| Molecular Formula | C26H37FOS |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 3-butyl-3-[[2-[(4-fluorophenyl)methyl]-4-methylphenyl]sulfanylmethyl]heptan-2-ol |
| SMILES | CCCCC(CCCC)(CSc1ccc(C)cc1Cc1ccc(F)cc1)C(C)O |
| InChI | InChI=1S/C26H37FOS/c1-5-7-15-26(21(4)28,16-8-6-2)19-29-25-14-9-20(3)17-23(25)18-22-10-12-24(27)13-11-22/h9-14,17,21,28H,5-8,15-16,18-19H2,1-4H3 |
| InChIKey | QTMMEFZEPVBRNR-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |