C22H24O5 — CID 10872291
(8S,12R)-3,20-dihydroxy-10,10-dimethyl-9,11-dioxatetracyclo[15.3.1.12,6.08,12]docosa-1(20),2,4,6(22),17(21),18-hexaen-14-one (PubChem CID 10872291) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is (8S,12R)-3,20-dihydroxy-10,10-dimethyl-9,11-dioxatetracyclo[15.3.1.12,6.08,12]docosa-1(20),2,4,6(22),17(21),18-hexaen-14-one.
| Compound Name | (8S,12R)-3,20-dihydroxy-10,10-dimethyl-9,11-dioxatetracyclo[15.3.1.12,6.08,12]docosa-1(20),2,4,6(22),17(21),18-hexaen-14-one |
|---|---|
| PubChem CID | 10872291 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (8S,12R)-3,20-dihydroxy-10,10-dimethyl-9,11-dioxatetracyclo[15.3.1.12,6.08,12]docosa-1(20),2,4,6(22),17(21),18-hexaen-14-one |
| SMILES | CC1(C)O[C@H]2Cc3ccc(O)c(c3)-c3cc(ccc3O)CCC(=O)C[C@H]2O1 |
| InChI | InChI=1S/C22H24O5/c1-22(2)26-20-11-14-5-8-19(25)17(10-14)16-9-13(4-7-18(16)24)3-6-15(23)12-21(20)27-22/h4-5,7-10,20-21,24-25H,3,6,11-12H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | QZMUQRSUCMFUHO-LEWJYISDSA-N |
| XLogP | 3.73 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |