C19H16Cl2N2OS — CID 108725447
2,4-dichloro-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide (PubChem CID 108725447) has the molecular formula C19H16Cl2N2OS and a molecular weight of 391.32 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 108725447 |
| Molecular Formula | C19H16Cl2N2OS |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 2,4-dichloro-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide |
| SMILES | Cc1nc(-c2ccc(CCNC(=O)c3ccc(Cl)cc3Cl)cc2)cs1 |
| InChI | InChI=1S/C19H16Cl2N2OS/c1-12-23-18(11-25-12)14-4-2-13(3-5-14)8-9-22-19(24)16-7-6-15(20)10-17(16)21/h2-7,10-11H,8-9H2,1H3,(H,22,24) |
| InChIKey | XMJKBLUNBDCELA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |