C15H21Cl3Se — CID 10872760
1,1,1-trichlorononan-3-ylselanylbenzene (PubChem CID 10872760) has the molecular formula C15H21Cl3Se and a molecular weight of 386.65 g/mol. Its IUPAC name is 1,1,1-trichlorononan-3-ylselanylbenzene.
| Compound Name | 1,1,1-trichlorononan-3-ylselanylbenzene |
|---|---|
| PubChem CID | 10872760 |
| Molecular Formula | C15H21Cl3Se |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 1,1,1-trichlorononan-3-ylselanylbenzene |
| SMILES | CCCCCCC(CC(Cl)(Cl)Cl)[Se]c1ccccc1 |
| InChI | InChI=1S/C15H21Cl3Se/c1-2-3-4-6-11-14(12-15(16,17)18)19-13-9-7-5-8-10-13/h5,7-10,14H,2-4,6,11-12H2,1H3 |
| InChIKey | RGCUGAIGQAGJPI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|