C26H24N6O2S — CID 108729096
2-ethyl-N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide (PubChem CID 108729096) has the molecular formula C26H24N6O2S and a molecular weight of 484.59 g/mol. Its IUPAC name is 2-ethyl-N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide.
| Compound Name | 2-ethyl-N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide |
|---|---|
| PubChem CID | 108729096 |
| Molecular Formula | C26H24N6O2S |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-ethyl-N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide |
| SMILES | CCN1CCc2nc3ccccc3c(C(=O)Nc3nc4scc(-c5ccc(OC)cc5)n4n3)c2C1 |
| InChI | InChI=1S/C26H24N6O2S/c1-3-31-13-12-21-19(14-31)23(18-6-4-5-7-20(18)27-21)24(33)28-25-29-26-32(30-25)22(15-35-26)16-8-10-17(34-2)11-9-16/h4-11,15H,3,12-14H2,1-2H3,(H,28,30,33) |
| InChIKey | WYWTUGUPFGAWCS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |