C19H15N5O3S — CID 108729182
(E)-N-[6-(4-acetamidophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 108729182) has the molecular formula C19H15N5O3S and a molecular weight of 393.43 g/mol. Its IUPAC name is (E)-N-[6-(4-acetamidophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[6-(4-acetamidophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108729182 |
| Molecular Formula | C19H15N5O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (E)-N-[6-(4-acetamidophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(-c2csc3nc(NC(=O)/C=C/c4ccco4)nn23)cc1 |
| InChI | InChI=1S/C19H15N5O3S/c1-12(25)20-14-6-4-13(5-7-14)16-11-28-19-22-18(23-24(16)19)21-17(26)9-8-15-3-2-10-27-15/h2-11H,1H3,(H,20,25)(H,21,23,26)/b9-8+ |
| InChIKey | GBDRPAJFLPUXKW-CMDGGOBGSA-N |
| XLogP | 3.66 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|