C19H11Cl3N4OS — CID 108752388
(E)-N-[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 108752388) has the molecular formula C19H11Cl3N4OS and a molecular weight of 449.75 g/mol. Its IUPAC name is (E)-N-[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108752388 |
| Molecular Formula | C19H11Cl3N4OS |
| Molecular Weight | 449.75 g/mol |
| Exact Mass | 447.97 |
| IUPAC Name | (E)-N-[6-(4-chlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)Nc1nc2scc(-c3ccc(Cl)cc3)n2n1 |
| InChI | InChI=1S/C19H11Cl3N4OS/c20-13-5-3-12(4-6-13)16-10-28-19-24-18(25-26(16)19)23-17(27)8-2-11-1-7-14(21)15(22)9-11/h1-10H,(H,23,25,27)/b8-2+ |
| InChIKey | RWXQRTLLRQGJQI-KRXBUXKQSA-N |
| XLogP | 6.07 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.75 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|