C15H12Cl2N4OS — CID 108751687
(E)-3-(3,4-dichlorophenyl)-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)prop-2-enamide (PubChem CID 108751687) has the molecular formula C15H12Cl2N4OS and a molecular weight of 367.26 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108751687 |
| Molecular Formula | C15H12Cl2N4OS |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)prop-2-enamide |
| SMILES | Cc1sc2nc(NC(=O)/C=C/c3ccc(Cl)c(Cl)c3)nn2c1C |
| InChI | InChI=1S/C15H12Cl2N4OS/c1-8-9(2)23-15-19-14(20-21(8)15)18-13(22)6-4-10-3-5-11(16)12(17)7-10/h3-7H,1-2H3,(H,18,20,22)/b6-4+ |
| InChIKey | ARWOGSVMHOGVNZ-GQCTYLIASA-N |
| XLogP | 4.37 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|