C15H13Cl2N3O3 — CID 1221544
3-(3,4-dichlorophenyl)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)prop-2-enamide (PubChem CID 1221544) has the molecular formula C15H13Cl2N3O3 and a molecular weight of 354.19 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1221544 |
| Molecular Formula | C15H13Cl2N3O3 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)prop-2-enamide |
| SMILES | Cn1c(NC(=O)C=Cc2ccc(Cl)c(Cl)c2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C15H13Cl2N3O3/c1-19-12(8-14(22)20(2)15(19)23)18-13(21)6-4-9-3-5-10(16)11(17)7-9/h3-8H,1-2H3,(H,18,21) |
| InChIKey | UUVBVSYSMBSVIJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|