C19H11Cl2FN4OS — CID 108752256
(E)-3-(3,4-dichlorophenyl)-N-[6-(4-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]prop-2-enamide (PubChem CID 108752256) has the molecular formula C19H11Cl2FN4OS and a molecular weight of 433.30 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[6-(4-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[6-(4-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108752256 |
| Molecular Formula | C19H11Cl2FN4OS |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[6-(4-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)Nc1nc2scc(-c3ccc(F)cc3)n2n1 |
| InChI | InChI=1S/C19H11Cl2FN4OS/c20-14-7-1-11(9-15(14)21)2-8-17(27)23-18-24-19-26(25-18)16(10-28-19)12-3-5-13(22)6-4-12/h1-10H,(H,23,25,27)/b8-2+ |
| InChIKey | DTENOUGLSZEPLH-KRXBUXKQSA-N |
| XLogP | 5.56 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|