C21H26N2O7 — CID 10873462
[(2R,3S,5R)-5-[(6R)-6-(2,2-dimethylpropanoyl)-2,4-dioxo-1,3-diazinan-1-yl]-3-hydroxyoxolan-2-yl]methyl benzoate (PubChem CID 10873462) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[(6R)-6-(2,2-dimethylpropanoyl)-2,4-dioxo-1,3-diazinan-1-yl]-3-hydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,5R)-5-[(6R)-6-(2,2-dimethylpropanoyl)-2,4-dioxo-1,3-diazinan-1-yl]-3-hydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10873462 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [(2R,3S,5R)-5-[(6R)-6-(2,2-dimethylpropanoyl)-2,4-dioxo-1,3-diazinan-1-yl]-3-hydroxyoxolan-2-yl]methyl benzoate |
| SMILES | CC(C)(C)C(=O)[C@H]1CC(=O)NC(=O)N1[C@H]1C[C@H](O)[C@@H](COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C21H26N2O7/c1-21(2,3)18(26)13-9-16(25)22-20(28)23(13)17-10-14(24)15(30-17)11-29-19(27)12-7-5-4-6-8-12/h4-8,13-15,17,24H,9-11H2,1-3H3,(H,22,25,28)/t13-,14+,15-,17-/m1/s1 |
| InChIKey | HUXDYADXMZCUFZ-JYYAWHABSA-N |
| XLogP | 1.25 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |