C14H10ClN5O — CID 108737124
7-chloro-N-(4-cyano-1-methylpyrazol-5-yl)-1H-indole-2-carboxamide (PubChem CID 108737124) has the molecular formula C14H10ClN5O and a molecular weight of 299.72 g/mol. Its IUPAC name is 7-chloro-N-(4-cyano-1-methylpyrazol-5-yl)-1H-indole-2-carboxamide.
| Compound Name | 7-chloro-N-(4-cyano-1-methylpyrazol-5-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 108737124 |
| Molecular Formula | C14H10ClN5O |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 7-chloro-N-(4-cyano-1-methylpyrazol-5-yl)-1H-indole-2-carboxamide |
| SMILES | Cn1ncc(C#N)c1NC(=O)c1cc2cccc(Cl)c2[nH]1 |
| InChI | InChI=1S/C14H10ClN5O/c1-20-13(9(6-16)7-17-20)19-14(21)11-5-8-3-2-4-10(15)12(8)18-11/h2-5,7,18H,1H3,(H,19,21) |
| InChIKey | QEJYSVXNPZBUCB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |