C12H10FN5O — CID 79503956
1-(4-cyano-1-methylpyrazol-5-yl)-3-(3-fluorophenyl)urea (PubChem CID 79503956) has the molecular formula C12H10FN5O and a molecular weight of 259.24 g/mol. Its IUPAC name is 1-(4-cyano-1-methylpyrazol-5-yl)-3-(3-fluorophenyl)urea.
| Compound Name | 1-(4-cyano-1-methylpyrazol-5-yl)-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 79503956 |
| Molecular Formula | C12H10FN5O |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-(4-cyano-1-methylpyrazol-5-yl)-3-(3-fluorophenyl)urea |
| SMILES | Cn1ncc(C#N)c1NC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C12H10FN5O/c1-18-11(8(6-14)7-15-18)17-12(19)16-10-4-2-3-9(13)5-10/h2-5,7H,1H3,(H2,16,17,19) |
| InChIKey | QONIBHVHDCIETC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |