C28H27NO5 — CID 108739919
5,7-dimethyl-1'-[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108739919) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is 5,7-dimethyl-1'-[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 5,7-dimethyl-1'-[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108739919 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 5,7-dimethyl-1'-[(E)-3-(6-methyl-4-oxochromen-3-yl)prop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc(C)c2c(c1)OC1(CCN(C(=O)/C=C/c3coc4ccc(C)cc4c3=O)CC1)CC2=O |
| InChI | InChI=1S/C28H27NO5/c1-17-4-6-23-21(13-17)27(32)20(16-33-23)5-7-25(31)29-10-8-28(9-11-29)15-22(30)26-19(3)12-18(2)14-24(26)34-28/h4-7,12-14,16H,8-11,15H2,1-3H3/b7-5+ |
| InChIKey | WYKXFKPXBUNQPW-FNORWQNLSA-N |
| XLogP | 4.76 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|