C18H20N4O — CID 108741356
(2E,4E)-1-(4-quinoxalin-2-ylpiperazin-1-yl)hexa-2,4-dien-1-one (PubChem CID 108741356) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is (2E,4E)-1-(4-quinoxalin-2-ylpiperazin-1-yl)hexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-(4-quinoxalin-2-ylpiperazin-1-yl)hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 108741356 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (2E,4E)-1-(4-quinoxalin-2-ylpiperazin-1-yl)hexa-2,4-dien-1-one |
| SMILES | C/C=C/C=C/C(=O)N1CCN(c2cnc3ccccc3n2)CC1 |
| InChI | InChI=1S/C18H20N4O/c1-2-3-4-9-18(23)22-12-10-21(11-13-22)17-14-19-15-7-5-6-8-16(15)20-17/h2-9,14H,10-13H2,1H3/b3-2+,9-4+ |
| InChIKey | OZRYNFQRBVOLMP-DSXPNFDZSA-N |
| XLogP | 2.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|