C14H18N4O — CID 26758368
(2E,4E)-1-(4-pyrimidin-2-ylpiperazin-1-yl)hexa-2,4-dien-1-one (PubChem CID 26758368) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is (2E,4E)-1-(4-pyrimidin-2-ylpiperazin-1-yl)hexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-(4-pyrimidin-2-ylpiperazin-1-yl)hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 26758368 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (2E,4E)-1-(4-pyrimidin-2-ylpiperazin-1-yl)hexa-2,4-dien-1-one |
| SMILES | C/C=C/C=C/C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H18N4O/c1-2-3-4-6-13(19)17-9-11-18(12-10-17)14-15-7-5-8-16-14/h2-8H,9-12H2,1H3/b3-2+,6-4+ |
| InChIKey | OIWDRXVIWHHDLY-WJPDYIDTSA-N |
| XLogP | 1.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|