C14H21N3OS — CID 100832897
(2Z,4E)-1-[4-[(5R)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]hexa-2,4-dien-1-one (PubChem CID 100832897) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is (2Z,4E)-1-[4-[(5R)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]hexa-2,4-dien-1-one.
| Compound Name | (2Z,4E)-1-[4-[(5R)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 100832897 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (2Z,4E)-1-[4-[(5R)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]hexa-2,4-dien-1-one |
| SMILES | C/C=C/C=C\C(=O)N1CCN(C2=NC[C@@H](C)S2)CC1 |
| InChI | InChI=1S/C14H21N3OS/c1-3-4-5-6-13(18)16-7-9-17(10-8-16)14-15-11-12(2)19-14/h3-6,12H,7-11H2,1-2H3/b4-3+,6-5-/t12-/m1/s1 |
| InChIKey | JFAAYJJBLJHMJY-WBOWPWJFSA-N |
| XLogP | 1.75 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|