C15H19N5O3S — CID 95783932
(4-amino-3-nitrophenyl)-[4-[(5R)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone (PubChem CID 95783932) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is (4-amino-3-nitrophenyl)-[4-[(5R)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone.
| Compound Name | (4-amino-3-nitrophenyl)-[4-[(5R)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 95783932 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (4-amino-3-nitrophenyl)-[4-[(5R)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone |
| SMILES | C[C@@H]1CN=C(N2CCN(C(=O)c3ccc(N)c([N+](=O)[O-])c3)CC2)S1 |
| InChI | InChI=1S/C15H19N5O3S/c1-10-9-17-15(24-10)19-6-4-18(5-7-19)14(21)11-2-3-12(16)13(8-11)20(22)23/h2-3,8,10H,4-7,9,16H2,1H3/t10-/m1/s1 |
| InChIKey | HZBNTDZPDPYIJN-SNVBAGLBSA-N |
| XLogP | 1.43 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|