C23H25ClN2O5S — CID 108742963
2-chloro-N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 108742963) has the molecular formula C23H25ClN2O5S and a molecular weight of 476.98 g/mol. Its IUPAC name is 2-chloro-N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 108742963 |
| Molecular Formula | C23H25ClN2O5S |
| Molecular Weight | 476.98 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 2-chloro-N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | CC1(C)CC(=O)c2cc(NC(=O)c3cc(S(=O)(=O)N4CCCCC4)ccc3Cl)ccc2O1 |
| InChI | InChI=1S/C23H25ClN2O5S/c1-23(2)14-20(27)18-12-15(6-9-21(18)31-23)25-22(28)17-13-16(7-8-19(17)24)32(29,30)26-10-4-3-5-11-26/h6-9,12-13H,3-5,10-11,14H2,1-2H3,(H,25,28) |
| InChIKey | WPOFKNCDLCIGCG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.98 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |