C22H23N3O5 — CID 108742981
N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 108742981) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 108742981 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | CC1(C)CC(=O)c2cc(NC(=O)c3ccc(N4CCCC4)c([N+](=O)[O-])c3)ccc2O1 |
| InChI | InChI=1S/C22H23N3O5/c1-22(2)13-19(26)16-12-15(6-8-20(16)30-22)23-21(27)14-5-7-17(18(11-14)25(28)29)24-9-3-4-10-24/h5-8,11-12H,3-4,9-10,13H2,1-2H3,(H,23,27) |
| InChIKey | KRNHPFBEBYCIFJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|