C19H18ClNO6 — CID 108745871
methyl 3-[[4-(5-chloro-2-methoxyphenyl)-4-oxobutanoyl]amino]-2-hydroxybenzoate (PubChem CID 108745871) has the molecular formula C19H18ClNO6 and a molecular weight of 391.81 g/mol. Its IUPAC name is methyl 3-[[4-(5-chloro-2-methoxyphenyl)-4-oxobutanoyl]amino]-2-hydroxybenzoate.
| Compound Name | methyl 3-[[4-(5-chloro-2-methoxyphenyl)-4-oxobutanoyl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 108745871 |
| Molecular Formula | C19H18ClNO6 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | methyl 3-[[4-(5-chloro-2-methoxyphenyl)-4-oxobutanoyl]amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CCC(=O)c2cc(Cl)ccc2OC)c1O |
| InChI | InChI=1S/C19H18ClNO6/c1-26-16-8-6-11(20)10-13(16)15(22)7-9-17(23)21-14-5-3-4-12(18(14)24)19(25)27-2/h3-6,8,10,24H,7,9H2,1-2H3,(H,21,23) |
| InChIKey | UQTWXGBHWRSVHZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|