C30H28ClN3O2 — CID 108750050
(E)-1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-phenyl-3-(4-propan-2-yloxyphenyl)prop-2-en-1-one (PubChem CID 108750050) has the molecular formula C30H28ClN3O2 and a molecular weight of 498.03 g/mol. Its IUPAC name is (E)-1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-phenyl-3-(4-propan-2-yloxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-phenyl-3-(4-propan-2-yloxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 108750050 |
| Molecular Formula | C30H28ClN3O2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | (E)-1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-phenyl-3-(4-propan-2-yloxyphenyl)prop-2-en-1-one |
| SMILES | CC(C)Oc1ccc(/C=C(/C(=O)N2CCc3[nH]nc(-c4cccc(Cl)c4)c3C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28ClN3O2/c1-20(2)36-25-13-11-21(12-14-25)17-26(22-7-4-3-5-8-22)30(35)34-16-15-28-27(19-34)29(33-32-28)23-9-6-10-24(31)18-23/h3-14,17-18,20H,15-16,19H2,1-2H3,(H,32,33)/b26-17+ |
| InChIKey | BPGNKQDLYNZRMY-YZSQISJMSA-N |
| XLogP | 6.64 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|