C25H18ClN3O3 — CID 108750516
2-(2-chlorophenyl)-N-(2-indol-1-ylethyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108750516) has the molecular formula C25H18ClN3O3 and a molecular weight of 443.89 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(2-indol-1-ylethyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-(2-indol-1-ylethyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108750516 |
| Molecular Formula | C25H18ClN3O3 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(2-indol-1-ylethyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(NCCn1ccc2ccccc21)c1ccc2c(c1)C(=O)N(c1ccccc1Cl)C2=O |
| InChI | InChI=1S/C25H18ClN3O3/c26-20-6-2-4-8-22(20)29-24(31)18-10-9-17(15-19(18)25(29)32)23(30)27-12-14-28-13-11-16-5-1-3-7-21(16)28/h1-11,13,15H,12,14H2,(H,27,30) |
| InChIKey | WSZVRFDCTDLCDA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|