C20H31HgO6 — CID 10875464
[(4aR,5S,8aS)-5-methoxycarbonyl-1-(2-methoxy-2-oxoethyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methylmercury;acetic acid (PubChem CID 10875464) has the molecular formula C20H31HgO6 and a molecular weight of 568.05 g/mol. Its IUPAC name is [(4aR,5S,8aS)-5-methoxycarbonyl-1-(2-methoxy-2-oxoethyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methylmercury;acetic acid.
| Compound Name | [(4aR,5S,8aS)-5-methoxycarbonyl-1-(2-methoxy-2-oxoethyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methylmercury;acetic acid |
|---|---|
| PubChem CID | 10875464 |
| Molecular Formula | C20H31HgO6 |
| Molecular Weight | 568.05 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | [(4aR,5S,8aS)-5-methoxycarbonyl-1-(2-methoxy-2-oxoethyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methylmercury;acetic acid |
| SMILES | CC(=O)O.COC(=O)CC1=C(C[Hg])CC[C@H]2[C@@](C)(C(=O)OC)CCC[C@]12C |
| InChI | InChI=1S/C18H27O4.C2H4O2.Hg/c1-12-7-8-14-17(2,13(12)11-15(19)21-4)9-6-10-18(14,3)16(20)22-5;1-2(3)4;/h14H,1,6-11H2,2-5H3;1H3,(H,3,4);/t14-,17-,18+;;/m1../s1 |
| InChIKey | CUHLCSBGBCTTQQ-JCIWTIDGSA-N |
| XLogP | 3.68 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.05 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|