C36H35NO5S — CID 10875672
5-[[4-[2-(oxan-2-yloxy)ethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione (PubChem CID 10875672) has the molecular formula C36H35NO5S and a molecular weight of 593.75 g/mol. Its IUPAC name is 5-[[4-[2-(oxan-2-yloxy)ethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(oxan-2-yloxy)ethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10875672 |
| Molecular Formula | C36H35NO5S |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | 5-[[4-[2-(oxan-2-yloxy)ethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(Cc2ccc(OCCOC3CCCCO3)cc2)C(=O)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H35NO5S/c38-34-32(26-27-19-21-31(22-20-27)40-24-25-42-33-18-10-11-23-41-33)43-35(39)37(34)36(28-12-4-1-5-13-28,29-14-6-2-7-15-29)30-16-8-3-9-17-30/h1-9,12-17,19-22,32-33H,10-11,18,23-26H2 |
| InChIKey | WJBQLBTZVHXITO-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|