C31H25NO5S — CID 23514191
2-[4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenoxy]acetic acid (PubChem CID 23514191) has the molecular formula C31H25NO5S and a molecular weight of 523.61 g/mol. Its IUPAC name is 2-[4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 23514191 |
| Molecular Formula | C31H25NO5S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 2-[4-[(2,4-dioxo-3-trityl-1,3-thiazolidin-5-yl)methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(CC2SC(=O)N(C(c3ccccc3)(c3ccccc3)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C31H25NO5S/c33-28(34)21-37-26-18-16-22(17-19-26)20-27-29(35)32(30(36)38-27)31(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-19,27H,20-21H2,(H,33,34) |
| InChIKey | IYIDPBYKPSUCKG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|