C33H29NO4S — CID 54107499
4-hydroxy-5-[[4-(2-oxobutoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one (PubChem CID 54107499) has the molecular formula C33H29NO4S and a molecular weight of 535.67 g/mol. Its IUPAC name is 4-hydroxy-5-[[4-(2-oxobutoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-5-[[4-(2-oxobutoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 54107499 |
| Molecular Formula | C33H29NO4S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 4-hydroxy-5-[[4-(2-oxobutoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one |
| SMILES | CCC(=O)COc1ccc(Cc2sc(=O)n(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2O)cc1 |
| InChI | InChI=1S/C33H29NO4S/c1-2-28(35)23-38-29-20-18-24(19-21-29)22-30-31(36)34(32(37)39-30)33(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-21,36H,2,22-23H2,1H3 |
| InChIKey | NETZXDNOPRSTDE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|