C26H23N3O7 — CID 108757051
ethyl 4-carbamoyl-5-[[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]-2-methylfuran-3-carboxylate (PubChem CID 108757051) has the molecular formula C26H23N3O7 and a molecular weight of 489.48 g/mol. Its IUPAC name is ethyl 4-carbamoyl-5-[[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]-2-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-carbamoyl-5-[[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108757051 |
| Molecular Formula | C26H23N3O7 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | ethyl 4-carbamoyl-5-[[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]-2-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)C(Cc2ccccc2)N2C(=O)c3ccccc3C2=O)c1C(N)=O |
| InChI | InChI=1S/C26H23N3O7/c1-3-35-26(34)19-14(2)36-23(20(19)21(27)30)28-22(31)18(13-15-9-5-4-6-10-15)29-24(32)16-11-7-8-12-17(16)25(29)33/h4-12,18H,3,13H2,1-2H3,(H2,27,30)(H,28,31) |
| InChIKey | HQPTZFVCEXMCSM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 149.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|