C23H32N2O6S — CID 108759094
4-butoxy-3-ethoxy-N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]benzamide (PubChem CID 108759094) has the molecular formula C23H32N2O6S and a molecular weight of 464.58 g/mol. Its IUPAC name is 4-butoxy-3-ethoxy-N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]benzamide.
| Compound Name | 4-butoxy-3-ethoxy-N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 108759094 |
| Molecular Formula | C23H32N2O6S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 4-butoxy-3-ethoxy-N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCc2ccc(S(=O)(=O)NCCOC)cc2)cc1OCC |
| InChI | InChI=1S/C23H32N2O6S/c1-4-6-14-31-21-12-9-19(16-22(21)30-5-2)23(26)24-17-18-7-10-20(11-8-18)32(27,28)25-13-15-29-3/h7-12,16,25H,4-6,13-15,17H2,1-3H3,(H,24,26) |
| InChIKey | ABDSUUAUJONVGI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|