C25H23N5O — CID 108759837
(E)-2-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazine-1-carbonyl]-3-phenylprop-2-enenitrile (PubChem CID 108759837) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is (E)-2-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazine-1-carbonyl]-3-phenylprop-2-enenitrile.
| Compound Name | (E)-2-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazine-1-carbonyl]-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 108759837 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (E)-2-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazine-1-carbonyl]-3-phenylprop-2-enenitrile |
| SMILES | Cc1nc(-c2ccccc2)cc(N2CCN(C(=O)/C(C#N)=C/c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C25H23N5O/c1-19-27-23(21-10-6-3-7-11-21)17-24(28-19)29-12-14-30(15-13-29)25(31)22(18-26)16-20-8-4-2-5-9-20/h2-11,16-17H,12-15H2,1H3/b22-16+ |
| InChIKey | ZRIUTMFZYYEJNJ-CJLVFECKSA-N |
| XLogP | 3.71 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|