C31H30N4O2 — CID 108759839
(E)-3-(4-methoxyphenyl)-1-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]-2-phenylprop-2-en-1-one (PubChem CID 108759839) has the molecular formula C31H30N4O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-1-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]-2-phenylprop-2-en-1-one.
| Compound Name | (E)-3-(4-methoxyphenyl)-1-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]-2-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 108759839 |
| Molecular Formula | C31H30N4O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-1-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]-2-phenylprop-2-en-1-one |
| SMILES | COc1ccc(/C=C(/C(=O)N2CCN(c3cc(-c4ccccc4)nc(C)n3)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H30N4O2/c1-23-32-29(26-11-7-4-8-12-26)22-30(33-23)34-17-19-35(20-18-34)31(36)28(25-9-5-3-6-10-25)21-24-13-15-27(37-2)16-14-24/h3-16,21-22H,17-20H2,1-2H3/b28-21+ |
| InChIKey | SPMPRXUOMPSADV-SGWCAAJKSA-N |
| XLogP | 5.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|