C29H36N4O2 — CID 108759867
4-(4-tert-butylphenoxy)-1-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]butan-1-one (PubChem CID 108759867) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-1-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-tert-butylphenoxy)-1-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108759867 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-1-[4-(2-methyl-6-phenylpyrimidin-4-yl)piperazin-1-yl]butan-1-one |
| SMILES | Cc1nc(-c2ccccc2)cc(N2CCN(C(=O)CCCOc3ccc(C(C)(C)C)cc3)CC2)n1 |
| InChI | InChI=1S/C29H36N4O2/c1-22-30-26(23-9-6-5-7-10-23)21-27(31-22)32-16-18-33(19-17-32)28(34)11-8-20-35-25-14-12-24(13-15-25)29(2,3)4/h5-7,9-10,12-15,21H,8,11,16-20H2,1-4H3 |
| InChIKey | FDGRAMFGYVDCIH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|