C16H11Cl4N3O3S — CID 108760206
N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 108760206) has the molecular formula C16H11Cl4N3O3S and a molecular weight of 467.16 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 108760206 |
| Molecular Formula | C16H11Cl4N3O3S |
| Molecular Weight | 467.16 g/mol |
| Exact Mass | 464.93 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | Cc1nc(CNC(=O)C(C)N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)cs1 |
| InChI | InChI=1S/C16H11Cl4N3O3S/c1-5(14(24)21-3-7-4-27-6(2)22-7)23-15(25)8-9(16(23)26)11(18)13(20)12(19)10(8)17/h4-5H,3H2,1-2H3,(H,21,24) |
| InChIKey | IYQBMTLGFPTVRX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.16 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|