C24H20N2O4 — CID 108763032
(E)-N-(4-acetyl-3-cyano-5-methylfuran-2-yl)-3-(4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 108763032) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is (E)-N-(4-acetyl-3-cyano-5-methylfuran-2-yl)-3-(4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-acetyl-3-cyano-5-methylfuran-2-yl)-3-(4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108763032 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (E)-N-(4-acetyl-3-cyano-5-methylfuran-2-yl)-3-(4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | CC(=O)c1c(C)oc(NC(=O)/C=C/c2ccc(OCc3ccccc3)cc2)c1C#N |
| InChI | InChI=1S/C24H20N2O4/c1-16(27)23-17(2)30-24(21(23)14-25)26-22(28)13-10-18-8-11-20(12-9-18)29-15-19-6-4-3-5-7-19/h3-13H,15H2,1-2H3,(H,26,28)/b13-10+ |
| InChIKey | BXKYKXJMJYNDPY-JLHYYAGUSA-N |
| XLogP | 4.89 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|