C22H19N3O2S2 — CID 55784983
(E)-N-[5-(cyanomethylsulfanyl)-4-methyl-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 55784983) has the molecular formula C22H19N3O2S2 and a molecular weight of 421.55 g/mol. Its IUPAC name is (E)-N-[5-(cyanomethylsulfanyl)-4-methyl-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-(cyanomethylsulfanyl)-4-methyl-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55784983 |
| Molecular Formula | C22H19N3O2S2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | (E)-N-[5-(cyanomethylsulfanyl)-4-methyl-1,3-thiazol-2-yl]-3-(4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | Cc1nc(NC(=O)/C=C/c2ccc(OCc3ccccc3)cc2)sc1SCC#N |
| InChI | InChI=1S/C22H19N3O2S2/c1-16-21(28-14-13-23)29-22(24-16)25-20(26)12-9-17-7-10-19(11-8-17)27-15-18-5-3-2-4-6-18/h2-12H,14-15H2,1H3,(H,24,25,26)/b12-9+ |
| InChIKey | VAKWKQOVKULFGN-FMIVXFBMSA-N |
| XLogP | 5.30 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|