C23H25N3O2S — CID 19195413
(E)-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-3-(4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 19195413) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is (E)-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-3-(4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-3-(4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19195413 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (E)-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-3-(4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | CCC(CC)c1nnc(NC(=O)/C=C/c2ccc(OCc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C23H25N3O2S/c1-3-19(4-2)22-25-26-23(29-22)24-21(27)15-12-17-10-13-20(14-11-17)28-16-18-8-6-5-7-9-18/h5-15,19H,3-4,16H2,1-2H3,(H,24,26,27)/b15-12+ |
| InChIKey | VVLFUSUPFNVYLF-NTCAYCPXSA-N |
| XLogP | 5.67 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|