C22H22N4O4 — CID 108763681
2-(1,3-dioxoisoindol-2-yl)-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]acetamide (PubChem CID 108763681) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 108763681 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]acetamide |
| SMILES | CN1CCN(C(=O)c2ccc(NC(=O)CN3C(=O)c4ccccc4C3=O)cc2)CC1 |
| InChI | InChI=1S/C22H22N4O4/c1-24-10-12-25(13-11-24)20(28)15-6-8-16(9-7-15)23-19(27)14-26-21(29)17-4-2-3-5-18(17)22(26)30/h2-9H,10-14H2,1H3,(H,23,27) |
| InChIKey | LNCJMJBNXMJXFZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|