C27H24N4O3 — CID 108766951
(E)-3-(2,4-dimethoxyphenyl)-N-[4-[(6-phenylpyrimidin-4-yl)amino]phenyl]prop-2-enamide (PubChem CID 108766951) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxyphenyl)-N-[4-[(6-phenylpyrimidin-4-yl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethoxyphenyl)-N-[4-[(6-phenylpyrimidin-4-yl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108766951 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (E)-3-(2,4-dimethoxyphenyl)-N-[4-[(6-phenylpyrimidin-4-yl)amino]phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc(Nc3cc(-c4ccccc4)ncn3)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H24N4O3/c1-33-23-14-8-20(25(16-23)34-2)9-15-27(32)31-22-12-10-21(11-13-22)30-26-17-24(28-18-29-26)19-6-4-3-5-7-19/h3-18H,1-2H3,(H,31,32)(H,28,29,30)/b15-9+ |
| InChIKey | XGIUWIUUEXIALA-OQLLNIDSSA-N |
| XLogP | 5.56 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|