C22H21N3O5S — CID 5044633
3-(2,4-dimethoxyphenyl)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 5044633) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | 3-(2,4-dimethoxyphenyl)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 5044633 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)Nc2ccc(S(=O)(=O)Nc3ccccn3)cc2)c(OC)c1 |
| InChI | InChI=1S/C22H21N3O5S/c1-29-18-10-6-16(20(15-18)30-2)7-13-22(26)24-17-8-11-19(12-9-17)31(27,28)25-21-5-3-4-14-23-21/h3-15H,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | PVDPPHHKQDTOIM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|